CAS 86408-36-8
:polymyxin B nonapeptide hydrochloride
Description:
Polymyxin B nonapeptide hydrochloride is a synthetic derivative of polymyxin B, which is an antibiotic derived from the bacterium Bacillus polymyxa. This compound is characterized by its structure, which consists of a cyclic peptide with a hydrophobic tail, contributing to its ability to disrupt bacterial cell membranes. It exhibits potent antimicrobial activity, particularly against Gram-negative bacteria, making it valuable in clinical settings for treating infections caused by multidrug-resistant organisms. The hydrochloride form enhances its solubility in aqueous solutions, facilitating its use in various pharmaceutical formulations. Polymyxin B nonapeptide hydrochloride is also noted for its lower toxicity compared to other polymyxins, which is advantageous for therapeutic applications. Additionally, it has been studied for its potential use in combination therapies to enhance the efficacy of other antibiotics. Its mechanism of action primarily involves binding to the lipopolysaccharides in the bacterial outer membrane, leading to cell lysis. Overall, this compound represents a significant tool in the fight against antibiotic-resistant infections.
Formula:C43H74N14O11
InChI:InChI=1/C43H74N14O11/c1-22(2)20-31-40(65)52-26(10-15-44)35(60)51-29(13-18-47)39(64)57-34(24(4)59)43(68)49-19-14-30(53-36(61)28(12-17-46)54-42(67)33(48)23(3)58)38(63)50-27(11-16-45)37(62)56-32(41(66)55-31)21-25-8-6-5-7-9-25/h5-9,22-24,26-34,58-59H,10-21,44-48H2,1-4H3,(H,49,68)(H,50,63)(H,51,60)(H,52,65)(H,53,61)(H,54,67)(H,55,66)(H,56,62)(H,57,64)/t23-,24-,26+,27+,28+,29+,30+,31+,32-,33+,34+/m1/s1
Synonyms:- Polymyxin B nonapeptide
- Pmbn
- Polymyxin B cyclononapeptide
- Polymyxin B1, 1-de(N2-(6-methyl-1-oxooctyl)-L-2,4-diaminobutanoic acid)-
- N-[(2S)-4-amino-1-oxo-1-{[(3S,6S,9S,12S,15R,18S,21S)-6,9,18-tris(2-aminoethyl)-15-benzyl-3-[(1R)-1-hydroxyethyl]-12-(2-methylpropyl)-2,5,8,11,14,17,20-heptaoxo-1,4,7,10,13,16,19-heptaazacyclotricosan-21-yl]amino}butan-2-yl]-L-threoninamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(2S,3R)-2-amino-N-[(1S)-3-amino-1-[[(3S,6S,9S,12S,15R,18S,21S)-6,9,18-tris(2-aminoethyl)-15-benzyl-3-(1-hydroxyethyl)-12-(2-methylpropyl)-2,5,8,11,14,17,20-heptaoxo-1,4,7,10,13,16,19-heptazacyclotricos-21-yl]carbamoyl]propyl]-3-hydroxy-butanamide
CAS:Formula:C43H74N14O11Purity:98%Molecular weight:963.1349Polymyxin B nonapeptide
CAS:Polymyxin B nonapeptide boosts hydrophobic antibiotic uptake in Gram-negative bacteria by enhancing membrane permeability.Formula:C43H74N14O11Purity:98%Color and Shape:SolidMolecular weight:963.13Polymyxin B Nonapeptide
CAS:Controlled ProductFormula:C43H74N14O11Color and Shape:NeatMolecular weight:963.135Polymyxin B nonapeptide hydrochloride
CAS:Polymyxin B nonapeptide hydrochloride is a potent antibiotic compound derived from the bacterium *Bacillus polymyxa*. As a cationic polypeptide, it exhibits its antibacterial activity by interacting with the lipopolysaccharides and phospholipids in the bacterial cell membrane, leading to increased permeability and ultimately causing cell lysis. The compound is specifically effective against a broad range of Gram-negative bacteria, making it crucial in studying antibiotic resistance mechanisms.
Formula:C43H74N14O11•(HCl)xPurity:Min. 95%Molecular weight:963.14 g/mol



