CAS 864082-72-4

3-Chloro-6-fluoro-5-nitro-1H-indazole

Description:

3-Chloro-6-fluoro-5-nitro-1H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a chlorine atom at the 3-position, a fluorine atom at the 6-position, and a nitro group at the 5-position contributes to its unique reactivity and properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its functional groups suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the presence of halogens and nitro groups can influence biological activity and lipophilicity. Additionally, the compound may participate in various chemical reactions, including nucleophilic substitutions and reductions, making it of interest for synthetic organic chemistry. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 3-Chloro-6-fluoro-5-nitro-1H-indazole is a versatile compound with potential applications in various fields of research.

Formula: C₇H₃ClFN₃O₂

InChI: InChI=1S/C7H3ClFN3O2/c8-7-3-1-6(12(13)14)4(9)2-5(3)10-11-7/h1-2H,(H,10,11)

InChI key: InChIKey=OCBXGVWBWHVZMO-UHFFFAOYSA-N

SMILES: ClC=1C=2C(=CC(F)=C(N(=O)=O)C2)NN1

Synonyms:

• 1H-Indazole, 3-chloro-6-fluoro-5-nitro-
• 3-Chloro-6-fluoro-5-nitro-1H-indazole