CAS 864146-96-3
:3-Fluoro-4-[4-(methylsulfonyl)-1-piperazinyl]benzenamine
Description:
3-Fluoro-4-[4-(methylsulfonyl)-1-piperazinyl]benzenamine, with the CAS number 864146-96-3, is a chemical compound characterized by its aromatic amine structure, which includes a fluorine atom and a piperazine moiety. The presence of the methylsulfonyl group enhances its solubility and may influence its biological activity. This compound is typically a solid at room temperature and exhibits moderate polarity due to the functional groups present. It is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The fluorine substitution can enhance the compound's metabolic stability and lipophilicity, while the piperazine ring may contribute to its ability to interact with biological targets, such as receptors or enzymes. Safety and handling considerations should be taken into account, as with any chemical substance, particularly regarding its potential toxicity and environmental impact.
Formula:C11H16FN3O2S
InChI:InChI=1S/C11H16FN3O2S/c1-18(16,17)15-6-4-14(5-7-15)11-3-2-9(13)8-10(11)12/h2-3,8H,4-7,13H2,1H3
InChI key:InChIKey=YBAMKIPBBHVKRN-UHFFFAOYSA-N
SMILES:FC1=C(N2CCN(S(C)(=O)=O)CC2)C=CC(N)=C1
Synonyms:- 3-Fluoro-4-(4-methanesulfonylpiperazin-1-yl)aniline
- 3-Fluoro-4-[4-(methylsulfonyl)-1-piperazinyl]benzenamine
- Benzenamine, 3-fluoro-4-[4-(methylsulfonyl)-1-piperazinyl]-
- [3-Fluoro-4-(4-methylsulfonylpiperazin-1-yl)phenyl]amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.