CymitQuimica logo

CAS 864231-66-3

:

(1-ethyl-1H-imidazol-2-yl)(phenyl)methanone

Description:
(1-ethyl-1H-imidazol-2-yl)(phenyl)methanone, identified by its CAS number 864231-66-3, is a chemical compound that features a unique structure combining an imidazole ring with a phenyl group. This compound typically exhibits characteristics common to imidazole derivatives, such as potential biological activity and the ability to participate in hydrogen bonding due to the presence of nitrogen atoms in the imidazole ring. The ethyl group enhances its lipophilicity, which may influence its solubility and interaction with biological membranes. The phenyl group contributes to the compound's aromaticity, potentially affecting its stability and reactivity. Such compounds are often studied for their applications in pharmaceuticals, agrochemicals, and materials science due to their diverse chemical properties. Additionally, the presence of both the imidazole and phenyl moieties may impart interesting electronic properties, making them suitable for various applications in organic synthesis and medicinal chemistry. Overall, this compound represents a fascinating intersection of structural features that can lead to diverse functional properties.
Formula:C12H12N2O
InChI:InChI=1/C12H12N2O/c1-2-14-9-8-13-12(14)11(15)10-6-4-3-5-7-10/h3-9H,2H2,1H3
SMILES:CCn1ccnc1C(=O)c1ccccc1
Synonyms:
  • methanone, (1-ethyl-1H-imidazol-2-yl)phenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.