CAS 864244-67-7

4-(2-Fluoro-4-nitrophenoxy)-2-pyridinamine

Description:

4-(2-Fluoro-4-nitrophenoxy)-2-pyridinamine, with the CAS number 864244-67-7, is a chemical compound characterized by its unique structural features, which include a pyridinamine moiety and a nitrophenoxy group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The fluorine atom in the structure can influence the compound's electronic properties, potentially enhancing its lipophilicity and biological activity. The nitro group is known for its electron-withdrawing characteristics, which can affect the compound's reactivity and interactions with biological targets. Additionally, the presence of the pyridinamine group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Overall, this compound's unique combination of functional groups may confer specific properties that could be exploited in various chemical and biological applications, including drug design and synthesis.

Formula: C₁₁H₈FN₃O₃

InChI: InChI=1S/C11H8FN3O3/c12-9-5-7(15(16)17)1-2-10(9)18-8-3-4-14-11(13)6-8/h1-6H,(H2,13,14)

InChI key: InChIKey=ARWPYOZMCQGHQS-UHFFFAOYSA-N

SMILES: O(C1=C(F)C=C(N(=O)=O)C=C1)C=2C=C(N)N=CC2

Synonyms:

• 4-(2-Fluoro-4-nitrophenoxy)-2-pyridinamine
• 2-Pyridinamine, 4-(2-fluoro-4-nitrophenoxy)-
• 4-(2-Fluoro-4-nitrophenoxy)pyridin-2-amine
• 4-(2-fluoro-4-nitro-phenoxy)pyridin-2-amine
• 2-Amino-4-(2-fluoro-4-nitrophenoxy)pyridine