CAS 864264-02-8

1-(1-methyl-1H-indol-4-yl)methanamine

Description:

1-(1-methyl-1H-indol-4-yl)methanamine, with the CAS number 864264-02-8, is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a methanamine functional group attached to the indole moiety, contributing to its potential biological activity. It is typically a solid at room temperature and may exhibit properties such as solubility in organic solvents, depending on its specific structure and substituents. The presence of the indole ring suggests potential interactions with biological systems, making it of interest in medicinal chemistry and pharmacology. Additionally, the methyl group on the indole nitrogen can influence its electronic properties and reactivity. As with many organic compounds, its stability, reactivity, and interactions can vary based on environmental conditions such as pH and temperature. Overall, this compound may serve as a valuable scaffold for the development of pharmaceuticals or other chemical applications.

Formula: C₁₀H₁₂N₂

InChI: InChI=1/C10H12N2/c1-12-6-5-9-8(7-11)3-2-4-10(9)12/h2-6H,7,11H2,1H3

SMILES: Cn1ccc2c(cccc12)CN

Synonyms:

• (1-methyl-1H-indol-4-yl)methylamine

(1-Methyl-1H-indol-4-yl)methanamine

CAS: 864264-02-8

Formula: C₁₀H₁₂N₂

Molecular weight: 160.2157

Ref: IN-DA004NLP

4-(Aminomethyl)-1-methyl-1H-indole

CAS: 864264-02-8

4-(Aminomethyl)-1-methyl-1H-indole

Formula: C₁₀H₁₂N₂

Purity: 97%

Color and Shape: solid

Molecular weight: 160.21568g/mol

Ref: 54-OR8682

(1-methyl-1H-indol-4-yl)methylamine

CAS: 864264-02-8

Purity: 95.0%

Molecular weight: 160.22000122070312

Ref: 10-F517844