CAS 864264-04-0
:Benzo[b]thiophene-4-methanamine
Description:
Benzo[b]thiophene-4-methanamine is an organic compound characterized by its structure, which includes a benzo[b]thiophene moiety and an amine functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the amine group. It is likely to be a solid at room temperature, with solubility in polar solvents depending on the specific substituents and their interactions. The presence of the thiophene ring contributes to its electronic properties, potentially allowing for applications in organic electronics or as a building block in synthetic chemistry. Additionally, the amine group may participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. As with many organic compounds, safety and handling precautions should be observed, as the compound may have specific toxicity or environmental impact considerations. Overall, Benzo[b]thiophene-4-methanamine represents a versatile structure with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C9H9NS
InChI:InChI=1S/C9H9NS/c10-6-7-2-1-3-9-8(7)4-5-11-9/h1-5H,6,10H2
InChI key:InChIKey=TZFMFHJVMMZUJF-UHFFFAOYSA-N
SMILES:C(N)C1=C2C(SC=C2)=CC=C1
Synonyms:- 1-Benzothiophen-4-ylmethanamine
- Benzo[b]thiophene-4-methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
