CymitQuimica logo

CAS 86427-78-3

:

1-hydrazinyl-4-phenylphthalazine

Description:
1-Hydrazinyl-4-phenylphthalazine, identified by its CAS number 86427-78-3, is an organic compound characterized by the presence of a hydrazine functional group and a phthalazine core. This compound features a phenyl group attached to the 4-position of the phthalazine ring, contributing to its aromatic properties. It typically exhibits a solid state at room temperature and may have moderate solubility in polar organic solvents. The presence of the hydrazine group suggests potential reactivity, particularly in redox reactions, and it may serve as a precursor or intermediate in various synthetic pathways. Additionally, compounds with hydrazine moieties are often investigated for their biological activities, including potential antitumor and antimicrobial properties. Safety considerations are important, as hydrazine derivatives can be toxic and potentially carcinogenic. Overall, 1-hydrazinyl-4-phenylphthalazine is of interest in both synthetic organic chemistry and medicinal chemistry due to its unique structural features and potential applications.
Formula:C14H12N4
InChI:InChI=1/C14H12N4/c15-16-14-12-9-5-4-8-11(12)13(17-18-14)10-6-2-1-3-7-10/h1-9H,15H2,(H,16,18)
SMILES:c1ccc(cc1)c1c2ccccc2c(=NN)[nH]n1
Synonyms:
  • 1-Hydrazino-4-phenylphthalazine
  • Phthalazine, 1-Hydrazinyl-4-Phenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.