
CAS 864291-31-6
:7-Quinazolinecarboxylic acid, 2,4-dichloro-, ethyl ester
Description:
7-Quinazolinecarboxylic acid, 2,4-dichloro-, ethyl ester is a chemical compound characterized by its quinazoline core structure, which is a bicyclic compound containing a benzene ring fused to a pyrimidine ring. This compound features a carboxylic acid functional group that is esterified with an ethyl group, enhancing its solubility and reactivity. The presence of two chlorine atoms at the 2 and 4 positions of the aromatic ring contributes to its unique chemical properties, potentially influencing its biological activity and reactivity. Typically, compounds of this nature may exhibit various pharmacological activities, making them of interest in medicinal chemistry. The molecular structure allows for potential interactions with biological targets, which can be explored for therapeutic applications. Additionally, the compound's stability, solubility, and reactivity can be influenced by the presence of the chlorine substituents and the ester functional group. Overall, 7-Quinazolinecarboxylic acid, 2,4-dichloro-, ethyl ester represents a class of compounds that may have significant implications in drug development and chemical synthesis.
Formula:C11H8Cl2N2O2
InChI:InChI=1S/C11H8Cl2N2O2/c1-2-17-10(16)6-3-4-7-8(5-6)14-11(13)15-9(7)12/h3-5H,2H2,1H3
InChI key:InChIKey=KBWIWYITXSRZIA-UHFFFAOYSA-N
SMILES:ClC=1C2=C(C=C(C(OCC)=O)C=C2)N=C(Cl)N1
Synonyms:- Ethyl 2,4-dichloroquinazoline-7-carboxylate
- 7-Quinazolinecarboxylic acid, 2,4-dichloro-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.