CymitQuimica logo

CAS 864291-87-2

:

tert-butyl 4-(3-hydroxy-1-piperidyl)piperidine-1-carboxylate

Description:
Tert-butyl 4-(3-hydroxy-1-piperidyl)piperidine-1-carboxylate, with the CAS number 864291-87-2, is a chemical compound characterized by its complex structure, which includes a tert-butyl group, piperidine rings, and a carboxylate functional group. This compound is typically classified as an organic molecule and may exhibit properties such as solubility in organic solvents, depending on the specific functional groups present. The presence of the hydroxyl group suggests potential for hydrogen bonding, which can influence its solubility and reactivity. Additionally, the piperidine moieties may contribute to its biological activity, making it of interest in medicinal chemistry. The compound's molecular structure can lead to various stereochemical configurations, which may affect its pharmacological properties. Overall, tert-butyl 4-(3-hydroxy-1-piperidyl)piperidine-1-carboxylate is a compound of interest for research and development in fields such as drug design and synthesis.
Formula:C15H28N2O3
InChI:InChI=1/C15H28N2O3/c1-15(2,3)20-14(19)16-9-6-12(7-10-16)17-8-4-5-13(18)11-17/h12-13,18H,4-11H2,1-3H3
SMILES:CC(C)(C)OC(=O)N1CCC(CC1)N1CCCC(C1)O
Synonyms:
  • tert-Butyl 3-hydroxy-1,4'-bipiperidine-1'-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.