CAS 864293-44-7

2-amino-5-bromo-3-methoxy-benzoic acid

Description:

2-Amino-5-bromo-3-methoxy-benzoic acid is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with an amino group, a bromo group, and a methoxy group, along with a carboxylic acid functional group. The presence of the amino group (-NH2) indicates that it can participate in hydrogen bonding, potentially enhancing its solubility in polar solvents. The bromo substituent introduces a halogen, which can influence the compound's reactivity and electronic properties, while the methoxy group (-OCH3) can affect the compound's polarity and steric hindrance. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the presence of multiple functional groups allows for various chemical reactions, including substitution and coupling reactions, which can be exploited in synthetic organic chemistry. Overall, 2-amino-5-bromo-3-methoxy-benzoic acid is a versatile compound with significant implications in both research and application.

Formula: C₈H₈BrNO₃

InChI: InChI=1/C8H8BrNO3/c1-13-6-3-4(9)2-5(7(6)10)8(11)12/h2-3H,10H2,1H3,(H,11,12)

SMILES: COc1cc(cc(c1N)C(=O)O)Br

Synonyms:

• 2-Amino-5-bromo-3-methoxybenzoic acid
• Benzoic Acid, 2-Amino-5-Bromo-3-Methoxy-
• 2-Amino-5-bromo-3-methoxybenzoic

2-Amino-5-bromo-3-methoxybenzoic acid

CAS: 864293-44-7

Formula: C₈H₈BrNO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 246.0580

Ref: IN-DA0036CX

2-Amino-5-bromo-3-methoxybenzoic acid

CAS: 864293-44-7

2-Amino-5-bromo-3-methoxybenzoic acid

Purity: 97%

Molecular weight: 246.06g/mol

Ref: 54-OR310923

2-Amino-5-bromo-3-methoxybenzoic acid

CAS: 864293-44-7

Formula: C₈H₈BrNO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 246.06

Ref: 10-F231989