CAS 864350-82-3

Hexahydro-N,N-dimethyl-1H-1,4-diazepine-1-ethanamine

Description:

Hexahydro-N,N-dimethyl-1H-1,4-diazepine-1-ethanamine, with the CAS number 864350-82-3, is a chemical compound characterized by its bicyclic structure, which includes a diazepine ring. This compound features a saturated hexahydro framework, indicating that it is fully hydrogenated, contributing to its stability and potential solubility in various solvents. The presence of N,N-dimethyl groups suggests that it has two methyl groups attached to the nitrogen atoms, which can influence its basicity and steric properties. The ethanamine moiety indicates that it has an amine functional group, which can participate in hydrogen bonding and may affect its reactivity and interaction with biological systems. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, although specific biological activities would require further investigation. Overall, its unique structural features position it as a potentially valuable compound in various chemical and pharmaceutical applications.

Formula: C₉H₂₁N₃

InChI: InChI=1S/C9H21N3/c1-11(2)8-9-12-6-3-4-10-5-7-12/h10H,3-9H2,1-2H3

InChI key: InChIKey=QBZGOGFWYSRNKC-UHFFFAOYSA-N

SMILES: C(CN(C)C)N1CCCNCC1

Synonyms:

• 1H-1,4-diazepine-1-ethanamine, hexahydro-N,N-dimethyl-
• Hexahydro-N,N-dimethyl-1H-1,4-diazepine-1-ethanamine
• N-[2-(1,4-diazepan-1-yl)ethyl]-N,N-dimethylamine
• [2-(1,4-Diazepan-1-yl)ethyl]dimethylamine
• 2-(1,4-Diazepan-1-yl)-N,N-dimethylethanamine

[2-(1,4-Diazepan-1-yl)ethyl]dimethylamine

CAS: 864350-82-3

[2-(1,4-Diazepan-1-yl)ethyl]dimethylamine

Molecular weight: 171.28314g/mol

Ref: 54-OR1020775

[2-(1,4-Diazepan-1-yl)ethyl]dimethylamine

CAS: 864350-82-3

Versatile small molecule scaffold

Formula: C₉H₂₁N₃

Purity: Min. 95%

Molecular weight: 171.28 g/mol

Ref: 3D-PJB35082