
CAS 864353-58-2
:2-(1-Chloroethyl)-6-methylpyridine
Description:
2-(1-Chloroethyl)-6-methylpyridine, with the CAS number 864353-58-2, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a chloroethyl group and a methyl group attached to the pyridine ring, influencing its chemical reactivity and physical properties. It is typically a colorless to pale yellow liquid with a distinctive odor. The presence of the chloroethyl group suggests potential reactivity in nucleophilic substitution reactions, while the methyl group can affect the compound's steric and electronic properties. This substance may be used in various chemical syntheses and applications, particularly in the field of pharmaceuticals or agrochemicals. Its solubility in organic solvents and relatively low boiling point make it suitable for specific industrial processes. As with many chlorinated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns. Always refer to safety data sheets for proper handling and disposal guidelines.
Formula:C8H10ClN
InChI:InChI=1S/C8H10ClN/c1-6-4-3-5-8(10-6)7(2)9/h3-5,7H,1-2H3
InChI key:InChIKey=RQGOOPNEQWYAGK-UHFFFAOYSA-N
SMILES:C(C)(Cl)C=1N=C(C)C=CC1
Synonyms:- 2-(1-Chloroethyl)-6-methylpyridine
- Pyridine, 2-(1-chloroethyl)-6-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.