CymitQuimica logo

CAS 864369-96-0

:

1,1-Dimethylethyl 4′-methyl[1,4′-bipiperidine]-1′-carboxylate

Description:
1,1-Dimethylethyl 4′-methyl[1,4′-bipiperidine]-1′-carboxylate, with the CAS number 864369-96-0, is a chemical compound characterized by its complex structure, which includes a bipiperidine moiety and a carboxylate functional group. This compound typically exhibits properties associated with both amines and esters, making it potentially useful in various chemical applications, including pharmaceuticals and agrochemicals. The presence of the dimethyl group contributes to its steric hindrance, which can influence its reactivity and interaction with biological targets. Additionally, the bipiperidine structure may impart specific pharmacological properties, such as enhanced binding affinity to certain receptors. The compound's solubility, stability, and reactivity can vary depending on the solvent and environmental conditions, which are important factors to consider in practical applications. Overall, 1,1-Dimethylethyl 4′-methyl[1,4′-bipiperidine]-1′-carboxylate represents a unique chemical entity with potential utility in various fields of research and industry.
Formula:C16H30N2O2
InChI:InChI=1S/C16H30N2O2/c1-15(2,3)20-14(19)17-12-8-16(4,9-13-17)18-10-6-5-7-11-18/h5-13H2,1-4H3
InChI key:InChIKey=KQDBEBIAZIIQIW-UHFFFAOYSA-N
SMILES:CC1(CCN(C(OC(C)(C)C)=O)CC1)N2CCCCC2
Synonyms:
  • 1,1-Dimethylethyl 4′-methyl[1,4′-bipiperidine]-1′-carboxylate
  • [1,4′-Bipiperidine]-1′-carboxylic acid, 4′-methyl-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.