CymitQuimica logo

CAS 864411-39-2

:

3-[[(Methylthio)carbonyl]amino]tricyclo[3.3.1.13,7]decane-1-acetic acid

Description:
3-[[(Methylthio)carbonyl]amino]tricyclo[3.3.1.13,7]decane-1-acetic acid is a complex organic compound characterized by its unique tricyclic structure, which consists of three interconnected cycloalkane rings. The presence of a methylthio group indicates that a sulfur atom is bonded to a methyl group, contributing to the compound's reactivity and potential biological activity. The carbonyl and amino functional groups suggest that this compound may participate in various chemical reactions, including amide formation and nucleophilic attacks. Additionally, the acetic acid moiety indicates the presence of a carboxylic acid functional group, which can influence solubility and acidity. This compound may exhibit interesting pharmacological properties due to its structural complexity and functional groups, making it a candidate for further research in medicinal chemistry. Its CAS number, 864411-39-2, allows for precise identification and retrieval of information regarding its synthesis, properties, and potential applications in various fields, including pharmaceuticals and materials science.
Formula:C14H21NO3S
InChI:InChI=1S/C14H21NO3S/c1-19-12(18)15-14-5-9-2-10(6-14)4-13(3-9,8-14)7-11(16)17/h9-10H,2-8H2,1H3,(H,15,18)(H,16,17)
InChI key:InChIKey=JQOPKTCDTCLMEC-UHFFFAOYSA-N
SMILES:N(C(SC)=O)C12CC3(CC(O)=O)CC(C1)CC(C2)C3
Synonyms:
  • Tricyclo[3.3.1.13,7]decane-1-acetic acid, 3-[[(methylthio)carbonyl]amino]-
  • 3-[[(Methylthio)carbonyl]amino]tricyclo[3.3.1.13,7]decane-1-acetic acid
  • tricyclo[3.3.1.1~3,7~]decane-1-acetic acid, 3-[[(methylthi
  • 2-[3-[[(methylthio)-oxomethyl]amino]-1-adamantyl]acetic acid
  • (3-{[(methylthio)carbonyl]amino}-1-adamantyl)acetic acid
  • 2-[3-[(methylthio)carbonylamino]-1-adamantyl]acetic acid
  • 2-[3-(methylsulfanylcarbonylamino)-1-adamantyl]ethanoic acid
  • 2-[3-(methylsulfanylcarbonylamino)-1-adamantyl]acetic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.