CymitQuimica logo

CAS 864415-55-4

:

[1-(4-fluorobenzyl)pyrrolidin-2-yl]methanol

Description:
[1-(4-fluorobenzyl)pyrrolidin-2-yl]methanol, with the CAS number 864415-55-4, is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring substituted with a 4-fluorobenzyl group and a hydroxymethyl group. This compound typically exhibits properties associated with both amines and alcohols, such as potential solubility in polar solvents due to the hydroxyl group, while the fluorobenzyl moiety may influence its lipophilicity and biological activity. The presence of the fluorine atom can enhance the compound's metabolic stability and alter its interaction with biological targets. Additionally, the pyrrolidine ring contributes to the compound's conformational flexibility, which can be significant in pharmacological contexts. Overall, this compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity and the influence of its functional groups on receptor interactions.
Formula:C12H16FNO
InChI:InChI=1/C12H16FNO/c13-11-5-3-10(4-6-11)8-14-7-1-2-12(14)9-15/h3-6,12,15H,1-2,7-9H2
SMILES:C1CC(CO)N(C1)Cc1ccc(cc1)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.