CAS 864436-94-2

5-[[(1,1-Dimethylethoxy)carbonyl]amino]-4-thiazolecarboxylic acid

Description:

5-[[(1,1-Dimethylethoxy)carbonyl]amino]-4-thiazolecarboxylic acid, with the CAS number 864436-94-2, is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features an amino group and a carboxylic acid functional group, contributing to its potential as a bioactive molecule. The presence of the 1,1-dimethylethoxycarbonyl group indicates that it has protective or modifying characteristics, which can influence its reactivity and solubility. Typically, compounds like this may exhibit properties such as antimicrobial or antifungal activity, making them of interest in pharmaceutical research. The thiazole moiety is often associated with various biological activities, and the specific functional groups can enhance the compound's interaction with biological targets. Overall, this compound's unique structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents.

Formula: C₉H₁₂N₂O₄S

InChI: InChI=1S/C9H12N2O4S/c1-9(2,3)15-8(14)11-6-5(7(12)13)10-4-16-6/h4H,1-3H3,(H,11,14)(H,12,13)

InChI key: InChIKey=SXJLZPMJYRHYDV-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(NC(OC(C)(C)C)=O)SC=N1

Synonyms:

• 5-[[(1,1-Dimethylethoxy)carbonyl]amino]-4-thiazolecarboxylic acid
• 5-(tert-Butoxycarbonylamino)thiazole-4-carboxylic acid
• 4-Thiazolecarboxylic acid, 5-[[(1,1-dimethylethoxy)carbonyl]amino]-