CAS 864501-59-7

Bromo[2-(1,3-dioxolan-2-yl-κO1)ethyl-κC]zinc

Description:

Bromo[2-(1,3-dioxolan-2-yl-κO1)ethyl-κC]zinc, with the CAS number 864501-59-7, is a chemical compound that features a zinc center coordinated to a bromo-substituted ethyl group and a 1,3-dioxolane moiety. The presence of the dioxolane ring suggests that this compound may exhibit properties associated with cyclic ethers, such as increased stability and potential reactivity in nucleophilic substitution reactions. The bromine atom serves as a good leaving group, which can facilitate various chemical transformations, including cross-coupling reactions. Zinc, being a transition metal, can participate in coordination chemistry and catalysis, making this compound potentially useful in organic synthesis. The specific arrangement of the substituents around the zinc center can influence the compound's reactivity, solubility, and interaction with other chemical species. Overall, this compound may find applications in synthetic organic chemistry, particularly in the development of new materials or pharmaceuticals, due to its unique structural features and reactivity profile.

Formula: C₅H₉BrO₂Zn

InChI: InChI=1S/C5H9O2.BrH.Zn/c1-2-5-6-3-4-7-5;;/h5H,1-4H2;1H;/q-1;;+2/p-1

InChI key: InChIKey=FBIHMCAQTQOHLI-UHFFFAOYSA-M

SMILES: [Br-][Zn+2]1O2C(OCC2)C[CH2-]1

Synonyms:

• Bromo[2-(1,3-dioxolan-2-yl)ethyl]zinc
• Bromo[2-(1,3-dioxolan-2-yl-κO1)ethyl-κC]zinc
• 2-[2-(1,3-Dioxolan-2-yl)ethyl]zinc bromide
• 2-(2-Dioxolanyl)ethylzinc bromide
• Zinc, bromo[2-(1,3-dioxolan-2-yl-κO1)ethyl-κC]-