
CAS 86451-37-8
:3-(Methylnitrosoamino)-1,2-propanediol
Description:
3-(Methylnitrosoamino)-1,2-propanediol, with the CAS number 86451-37-8, is a chemical compound that belongs to the class of nitrosamines, which are known for their potential carcinogenic properties. This substance is characterized by the presence of a nitroso group (-NO) attached to a methylnitrosoamino moiety, which is further linked to a propanediol structure. The compound is typically a colorless to pale yellow liquid and is soluble in water and organic solvents, reflecting its polar nature due to the hydroxyl groups present. It is primarily studied in the context of its biological effects, particularly its role in the formation of DNA adducts, which can lead to mutations and cancer. Due to its potential health risks, handling and exposure to this compound are subject to strict regulations in laboratory and industrial settings. Safety data sheets should be consulted for proper handling procedures, as nitrosamines are generally regarded as hazardous substances.
Formula:C4H10N2O3
InChI:InChI=1S/C4H10N2O3/c1-6(5-9)2-4(8)3-7/h4,7-8H,2-3H2,1H3
InChI key:InChIKey=YHOZMWRNWDWYKJ-UHFFFAOYSA-N
SMILES:C(C(CO)O)N(N=O)C
Synonyms:- 3-(Methylnitrosoamino)-1,2-propanediol
- 1,2-Propanediol, 3-(methylnitrosoamino)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.