
CAS 864528-34-7
:4-(Azidomethyl)pyridine
Description:
4-(Azidomethyl)pyridine is an organic compound characterized by the presence of a pyridine ring substituted with an azidomethyl group. Its molecular structure features a five-membered aromatic ring containing nitrogen, which contributes to its unique chemical properties. The azido group (-N3) is known for its reactivity, particularly in click chemistry and as a precursor for various nitrogen-containing compounds. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is soluble in polar organic solvents, making it useful in various synthetic applications. The presence of both the azido and pyridine functionalities allows for diverse reactivity, including nucleophilic substitutions and coupling reactions. However, due to the azido group, it must be handled with caution as it can be explosive under certain conditions. Overall, 4-(Azidomethyl)pyridine serves as a valuable intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals.
Formula:C6H6N4
InChI:InChI=1S/C6H6N4/c7-10-9-5-6-1-3-8-4-2-6/h1-4H,5H2
InChI key:InChIKey=GDJCWJYAEHAJPS-UHFFFAOYSA-N
SMILES:C(N=[N+]=[N-])C=1C=CN=CC1
Synonyms:- Pyridine, 4-(azidomethyl)-
- 4-(Azidomethyl)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.