
CAS 86456-69-1
:6-Bromo-1-(bromomethyl)naphthalene
Description:
6-Bromo-1-(bromomethyl)naphthalene is an organic compound characterized by its naphthalene backbone substituted with bromine atoms. Specifically, it features a bromine atom at the 6-position and a bromomethyl group at the 1-position of the naphthalene ring. This compound is typically a solid at room temperature and may exhibit a crystalline structure. Its molecular formula reflects the presence of multiple bromine substituents, which can influence its reactivity and physical properties, such as solubility and melting point. The presence of bromine atoms generally enhances the compound's electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, due to its halogenated nature, 6-Bromo-1-(bromomethyl)naphthalene may have applications in organic synthesis, materials science, and potentially in the development of pharmaceuticals. Safety considerations should be taken into account when handling this compound, as brominated compounds can be hazardous.
Formula:C11H8Br2
InChI:InChI=1S/C11H8Br2/c12-7-9-3-1-2-8-6-10(13)4-5-11(8)9/h1-6H,7H2
InChI key:InChIKey=OFUWLIWMZOLNEJ-UHFFFAOYSA-N
SMILES:C(Br)C=1C2=C(C=C(Br)C=C2)C=CC1
Synonyms:- Naphthalene, 6-bromo-1-(bromomethyl)-
- 6-Bromo-1-(bromomethyl)naphthalene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.