CAS 86456-97-5

3-Ethoxy-4-methoxyphenethylamine

Description:

3-Ethoxy-4-methoxyphenethylamine, identified by its CAS number 86456-97-5, is a chemical compound that belongs to the class of phenethylamines. This substance features a phenethylamine backbone, which is characterized by a two-carbon chain (ethyl) attached to a phenolic ring. The presence of ethoxy and methoxy groups on the aromatic ring contributes to its unique chemical properties, influencing its solubility and reactivity. Generally, compounds in this class can exhibit psychoactive effects, and their biological activity is often linked to interactions with neurotransmitter systems. The specific characteristics of 3-Ethoxy-4-methoxyphenethylamine, such as its melting point, boiling point, and solubility, may vary and are typically determined through experimental methods. Additionally, safety and handling information is crucial, as with many organic compounds, to ensure proper laboratory practices. As with any chemical, understanding its structure-activity relationship is essential for exploring its potential applications in pharmacology or medicinal chemistry.

Formula: C₁₁H₁₇NO₂

InChI: InChI=1/C11H17NO2/c1-3-14-11-8-9(6-7-12)4-5-10(11)13-2/h4-5,8H,3,6-7,12H2,1-2H3

SMILES: CCOc1cc(ccc1OC)CCN

Synonyms:

• 2-(3-Ethoxy-4-Methoxyphenyl)Ethanamine