CAS 86456-98-6

2-(3-methoxy-4-propoxyphenyl)ethanaminato

Description:

2-(3-methoxy-4-propoxyphenyl)ethanaminato, with the CAS number 86456-98-6, is a chemical compound characterized by its specific functional groups and structural features. It contains an ethanamine backbone, which is an amine derivative, indicating the presence of an amino group (-NH2) attached to an ethyl chain. The compound also features a substituted phenyl ring, which includes both methoxy (-OCH3) and propoxy (-OCH2CH2CH3) groups, contributing to its hydrophobic characteristics and potentially influencing its solubility and reactivity. The presence of these substituents can affect the compound's biological activity, making it of interest in medicinal chemistry. Additionally, the molecular structure suggests that it may exhibit specific interactions with biological targets, which could be relevant for pharmacological applications. Overall, the unique combination of functional groups and the phenyl ring structure makes this compound a subject of interest for further research in various chemical and biological contexts.

Formula: C₁₂H₁₉NO₂

InChI: InChI=1/C12H19NO2/c1-3-8-15-11-5-4-10(6-7-13)9-12(11)14-2/h4-5,9H,3,6-8,13H2,1-2H3

SMILES: CCCOc1ccc(CCN)cc1OC

Synonyms:

• 2-(3-Methoxy-4-propoxyphenyl)ethanamine
• Benzeneethanamine, 3-Methoxy-4-Propoxy-