CymitQuimica logo

CAS 864680-71-7

:

3-(4-Aminophenyl)-1,2,4-oxadiazol-5(2H)-one

Description:
3-(4-Aminophenyl)-1,2,4-oxadiazol-5(2H)-one, identified by its CAS number 864680-71-7, is a heterocyclic organic compound featuring an oxadiazole ring. This compound is characterized by the presence of an amino group attached to a phenyl ring, which contributes to its potential biological activity. The oxadiazole moiety is known for its stability and ability to participate in various chemical reactions, making it a valuable scaffold in medicinal chemistry. The compound may exhibit properties such as antimicrobial, anti-inflammatory, or anticancer activities, although specific biological activities would depend on further empirical studies. Its solubility and reactivity can vary based on the functional groups present, influencing its application in pharmaceuticals or as a research chemical. Additionally, the compound's structural features suggest potential for interactions with biological targets, making it of interest in drug development. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C8H7N3O2
InChI:InChI=1S/C8H7N3O2/c9-6-3-1-5(2-4-6)7-10-8(12)13-11-7/h1-4H,9H2,(H,10,11,12)
InChI key:InChIKey=DCTSCCYMGLMYKY-UHFFFAOYSA-N
SMILES:O=C1NC(C2=CC=C(N)C=C2)=NO1
Synonyms:
  • 3-(4-Aminophenyl)-1,2,4-oxadiazol-5(2H)-one
  • 3-(4-Aminophenyl)-1,2,4-oxadiazol-5(4H)-one
  • 1,2,4-Oxadiazol-5(2H)-one, 3-(4-aminophenyl)-
Found 4 products.