
CAS 864684-73-1
:N-(3-Methyl-5-isothiazolyl)-2-pyridinemethanamine
Description:
N-(3-Methyl-5-isothiazolyl)-2-pyridinemethanamine, identified by its CAS number 864684-73-1, is a chemical compound that features a pyridine ring and an isothiazole moiety. This compound is characterized by its unique structural arrangement, which contributes to its potential biological activity. The presence of the isothiazole group often imparts antimicrobial or antifungal properties, making it of interest in various applications, including pharmaceuticals and agrochemicals. The methyl group on the isothiazole enhances its lipophilicity, potentially affecting its solubility and permeability in biological systems. Additionally, the amine functional group in the structure can participate in hydrogen bonding, influencing its reactivity and interaction with other molecules. Overall, this compound's characteristics suggest it may have significant utility in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific safety and handling guidelines should be followed due to the potential hazards associated with its chemical properties.
Formula:C10H11N3S
InChI:InChI=1S/C10H11N3S/c1-8-6-10(14-13-8)12-7-9-4-2-3-5-11-9/h2-6,12H,7H2,1H3
InChI key:InChIKey=RXUIEDCFXIRKSI-UHFFFAOYSA-N
SMILES:N(CC1=CC=CC=N1)C=2SN=C(C)C2
Synonyms:- N-(3-Methyl-5-isothiazolyl)-2-pyridinemethanamine
- 2-Pyridinemethanamine, N-(3-methyl-5-isothiazolyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.