CAS 864723-36-4

1-(2-chloroethyl)-1H-pyrazole-4-carbaldehyde

Description:

1-(2-Chloroethyl)-1H-pyrazole-4-carbaldehyde is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. The presence of a chloroethyl group introduces a halogen and an alkyl chain, enhancing its reactivity and potential applications in organic synthesis. The aldehyde functional group (-CHO) at the 4-position of the pyrazole ring is significant for its reactivity, allowing for various chemical transformations, such as condensation reactions and nucleophilic additions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and agrochemical research. Its molecular structure contributes to its physical properties, such as solubility and volatility, which can influence its behavior in different environments. Additionally, the compound's CAS number, 864723-36-4, serves as a unique identifier for regulatory and safety information. Overall, 1-(2-chloroethyl)-1H-pyrazole-4-carbaldehyde is a versatile compound with potential applications in various fields of chemistry.

Formula: C₆H₇ClN₂O

InChI: InChI=1/C6H7ClN2O/c7-1-2-9-4-6(5-10)3-8-9/h3-5H,1-2H2

SMILES: C(Cn1cc(cn1)C=O)Cl

1-(2-chloroethyl)-1H-pyrazole-4-carbaldehyde

CAS: 864723-36-4

Formula: C₆H₇ClN₂O

Purity: 95.0%

Molecular weight: 158.59

Ref: 10-F308947

1-(2-Chloroethyl)-1H-pyrazole-4-carbaldehyde

CAS: 864723-36-4

Versatile small molecule scaffold

Formula: C₆H₇ClN₂O

Purity: Min. 95%

Molecular weight: 158.59 g/mol

Ref: 3D-PJB72336