CAS 864724-64-1

3-iodo-7-nitro-1H-indazole

Description:

3-Iodo-7-nitro-1H-indazole is a chemical compound characterized by its unique structure, which includes an indazole core substituted with an iodine atom at the 3-position and a nitro group at the 7-position. This compound is typically a solid at room temperature and may exhibit a range of physical properties such as solubility in organic solvents, depending on the specific conditions. The presence of the iodine atom contributes to its potential reactivity and applications in various chemical reactions, while the nitro group can influence its electronic properties and reactivity. 3-Iodo-7-nitro-1H-indazole may be of interest in medicinal chemistry and materials science due to its potential biological activity and utility in synthesizing other complex molecules. As with many nitro-substituted compounds, it may also exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, aiding in its identification and characterization. Safety and handling precautions should be observed, as with all chemical substances, particularly those containing halogens and nitro groups.

Formula: C₇H₄IN₃O₂

InChI: InChI=1/C7H4IN3O2/c8-7-4-2-1-3-5(11(12)13)6(4)9-10-7/h1-3H,(H,9,10)

SMILES: c1cc2c(c(c1)N(=O)=O)[nH]nc2I

3-Iodo-7-nitro-1H-indazole

CAS: 864724-64-1

Formula: C₇H₄IN₃O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 289.0300

Ref: IN-DA004MQD

3-Iodo-7-nitro-1H-indazole

CAS: 864724-64-1

3-Iodo-7-nitro-1H-indazole

Purity: 98%

Molecular weight: 289.03g/mol

Ref: 54-OR90783

3-Iodo-7-nitro-1H-indazole

CAS: 864724-64-1

Formula: C₇H₄IN₃O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 289.032

Ref: 10-F336577

3-IODO-7-NITRO-1H-INDAZOLE

CAS: 864724-64-1

Purity: 98%

Molecular weight: 289.0320129

Ref: 10-F794488

3-iodo-7-nitro-1H-indazole

CAS: 864724-64-1

3-Iodo-7-nitro-1H-indazole is a synthetic compound that can be used as a cross-coupling reaction intermediate for the synthesis of trisubstituted indazoles. It is an effective inhibitor of murine leukemia, and has been shown to have efficacy against human leukemia cells in vitro. 3-Iodo-7-nitro-1H-indazole has been shown to inhibit the growth of L1210 murine leukemia cells by inhibiting DNA synthesis and cell cycle progression.

Formula: C₇H₄IN₃O₂

Purity: Min. 95%

Molecular weight: 289.03 g/mol

Ref: 3D-PJB72464