
CAS 864754-09-6
:2-[4-(1,3-Dioxolan-2-ylmethoxy)-3-methoxyphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Description:
2-[4-(1,3-Dioxolan-2-ylmethoxy)-3-methoxyphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is a boron-containing organic compound characterized by its unique dioxaborolane structure, which features a five-membered ring containing boron and oxygen. This compound typically exhibits properties associated with boron compounds, such as potential applications in organic synthesis and medicinal chemistry due to its ability to form stable complexes with various substrates. The presence of methoxy and dioxolane groups suggests that it may have enhanced solubility in organic solvents and could participate in various chemical reactions, including nucleophilic substitutions and cross-coupling reactions. Additionally, the compound's structure may confer specific biological activities, making it of interest in pharmaceutical research. Its stability, reactivity, and functional group diversity are key characteristics that can influence its behavior in chemical reactions and potential applications in material science and drug development. As with many boron compounds, careful handling and consideration of safety protocols are essential due to their reactivity and potential toxicity.
Formula:C17H25BO6
InChI:InChI=1S/C17H25BO6/c1-16(2)17(3,4)24-18(23-16)12-6-7-13(14(10-12)19-5)22-11-15-20-8-9-21-15/h6-7,10,15H,8-9,11H2,1-5H3
InChI key:InChIKey=OZCFFLHABBNLFP-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C2=CC(OC)=C(OCC3OCCO3)C=C2
Synonyms:- 2-[4-(1,3-Dioxolan-2-ylmethoxy)-3-methoxyphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
- 1,3,2-Dioxaborolane, 2-[4-(1,3-dioxolan-2-ylmethoxy)-3-methoxyphenyl]-4,4,5,5-tetramethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-[4-([1,3]Dioxolan-2-ylmethoxy)-3-methoxy-phenyl]-4,4,5,5-tetramethyl-[1,3,2]dioxaborolane
CAS:Formula:C17H25BO6Molecular weight:336.1878
