CymitQuimica logo

CAS 864754-10-9

:

4-[2-[2-Methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl]morpholine

Description:
4-[2-[2-Methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl]morpholine, with CAS number 864754-10-9, is a synthetic organic compound characterized by its complex molecular structure, which includes a morpholine ring and a boron-containing moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential stability under standard laboratory conditions. The presence of the dioxaborolane group suggests it may participate in boron chemistry, potentially serving as a reagent or intermediate in organic synthesis. The methoxy and phenoxy groups contribute to its hydrophobic characteristics, influencing its interactions with biological systems and other chemical entities. Additionally, the morpholine component may impart basicity, affecting its reactivity and potential applications in medicinal chemistry or material science. Overall, this compound's unique structure positions it as a candidate for further research in various chemical applications, including drug development and polymer chemistry.
Formula:C19H30BNO5
InChI:InChI=1S/C19H30BNO5/c1-18(2)19(3,4)26-20(25-18)15-6-7-16(17(14-15)22-5)24-13-10-21-8-11-23-12-9-21/h6-7,14H,8-13H2,1-5H3
InChI key:InChIKey=AKWVETXQYCEUAF-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C2=CC(OC)=C(OCCN3CCOCC3)C=C2
Synonyms:
  • Morpholine, 4-[2-[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl]-
  • 4-[2-[2-Methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl]morpholine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.