CymitQuimica logo

CAS 864754-12-1

:

2-[2-(1,3-Dioxolan-2-ylmethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane

Description:
2-[2-(1,3-Dioxolan-2-ylmethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is a boron-containing organic compound characterized by its unique structure, which includes a dioxaborolane ring and a phenyl group substituted with a dioxolane moiety. This compound typically exhibits properties associated with boron compounds, such as potential applications in organic synthesis and materials science due to its ability to participate in various chemical reactions, including cross-coupling reactions. The presence of the dioxolane group may enhance solubility and stability, while the tetramethyl substitution on the dioxaborolane ring can influence its reactivity and steric properties. Additionally, this compound may exhibit interesting electronic properties due to the conjugation between the phenyl and dioxaborolane moieties. Its specific applications could range from pharmaceuticals to agrochemicals, depending on its reactivity and functionalization potential. As with many boron compounds, safety and handling precautions should be observed due to potential toxicity and reactivity.
Formula:C16H23BO5
InChI:InChI=1S/C16H23BO5/c1-15(2)16(3,4)22-17(21-15)12-7-5-6-8-13(12)20-11-14-18-9-10-19-14/h5-8,14H,9-11H2,1-4H3
InChI key:InChIKey=MWZSVLSZRVYSFZ-UHFFFAOYSA-N
SMILES:O(CC1OCCO1)C2=C(C=CC=C2)B3OC(C)(C)C(C)(C)O3
Synonyms:
  • 1,3,2-Dioxaborolane, 2-[2-(1,3-dioxolan-2-ylmethoxy)phenyl]-4,4,5,5-tetramethyl-
  • 2-[2-(1,3-Dioxolan-2-ylmethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.