CymitQuimica logo

CAS 864754-19-8

:

4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(thiophen-2-ylmethyl)-1H-pyrazole

Description:
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(thiophen-2-ylmethyl)-1H-pyrazole is a chemical compound characterized by its unique structural features, which include a pyrazole ring and a thiophene moiety. The presence of the dioxaborolane group suggests that it may have applications in organoboron chemistry, particularly in cross-coupling reactions or as a reagent in organic synthesis. The compound is likely to exhibit moderate to high stability under standard laboratory conditions, although specific stability can depend on environmental factors such as temperature and moisture. Its molecular structure may confer specific reactivity patterns, making it a candidate for further functionalization or use in medicinal chemistry. Additionally, the presence of the thiophene ring may impart interesting electronic properties, potentially influencing its behavior in electronic applications or as a ligand in coordination chemistry. Overall, this compound represents a versatile building block in synthetic organic chemistry, with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C14H19BN2O2S
InChI:InChI=1/C14H19BN2O2S/c1-13(2)14(3,4)19-15(18-13)11-8-16-17(9-11)10-12-6-5-7-20-12/h5-9H,10H2,1-4H3
InChI key:ANSBFDYOIUZSNT-UHFFFAOYSA-N
SMILES:CC1(C)C(C)(C)OB(c2cnn(c2)Cc2cccs2)O1
Found 4 products.