CymitQuimica logo

CAS 864754-21-2

:

3-{[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-1-yl]methyl}pyridine

Description:
3-{[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-1-yl]methyl}pyridine, with CAS number 864754-21-2, is a chemical compound characterized by its complex structure that includes a pyridine ring and a pyrazole moiety, linked through a methylene bridge. The presence of the boron-containing dioxaborolane group contributes to its potential reactivity and utility in various chemical applications, particularly in organic synthesis and medicinal chemistry. This compound may exhibit properties such as solubility in organic solvents, stability under certain conditions, and the ability to participate in coordination chemistry due to the boron atom. Its unique structure suggests potential applications in drug development, agrochemicals, or as a building block in materials science. Additionally, the presence of multiple functional groups may allow for further derivatization, enhancing its versatility in synthetic pathways. As with many boron-containing compounds, it may also exhibit interesting electronic properties, making it a subject of interest in research and development.
Formula:C15H20BN3O2
InChI:InChI=1/C15H20BN3O2/c1-14(2)15(3,4)21-16(20-14)13-9-18-19(11-13)10-12-6-5-7-17-8-12/h5-9,11H,10H2,1-4H3
InChI key:LVLQAPQDEZOFQU-UHFFFAOYSA-N
SMILES:CC1(C)C(C)(C)OB(c2cnn(Cc3cccnc3)c2)O1
Found 4 products.