
CAS 864754-24-5
:N-(3-Pyridinylmethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide
Description:
N-(3-Pyridinylmethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide, with CAS number 864754-24-5, is a chemical compound characterized by its complex structure, which includes a pyridine ring and a boron-containing dioxaborolane moiety. This compound typically exhibits properties such as moderate solubility in organic solvents, which is common for compounds containing aromatic and heterocyclic structures. The presence of the dioxaborolane group suggests potential applications in medicinal chemistry, particularly in drug design and development, due to its ability to participate in various chemical reactions, including Suzuki coupling. The compound may also display biological activity, making it of interest in pharmacological studies. Its molecular structure allows for interactions with biological targets, potentially influencing its efficacy and safety profile. As with many organic compounds, handling should be done with care, considering safety data sheets for proper guidelines on toxicity and reactivity.
Formula:C19H23BN2O3
InChI:InChI=1S/C19H23BN2O3/c1-18(2)19(3,4)25-20(24-18)16-9-7-15(8-10-16)17(23)22-13-14-6-5-11-21-12-14/h5-12H,13H2,1-4H3,(H,22,23)
InChI key:InChIKey=RVMXBWUGABZGBK-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C2=CC=C(C(NCC=3C=CC=NC3)=O)C=C2
Synonyms:- N-(3-Pyridinylmethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide
- Benzamide, N-(3-pyridinylmethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-(3-Pyridinylmethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide
CAS:Formula:C19H23BN2O3Molecular weight:338.2085
