CymitQuimica logo

CAS 864754-25-6

:

N-(4-Pyridinylmethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide

Description:
N-(4-Pyridinylmethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide, identified by its CAS number 864754-25-6, is a chemical compound characterized by its complex structure that includes a pyridine ring and a boron-containing moiety. The presence of the pyridinylmethyl group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The dioxaborolane unit is notable for its role in various chemical reactions, including those involving boron chemistry, which can facilitate the formation of carbon-boron bonds. This compound may exhibit properties such as solubility in organic solvents, stability under certain conditions, and potential reactivity with nucleophiles or electrophiles, making it a candidate for further study in synthetic organic chemistry. Its unique structure may also impart specific biological activities, warranting investigation into its pharmacological properties. Overall, this compound represents a valuable entity in the realm of chemical research and development.
Formula:C19H23BN2O3
InChI:InChI=1S/C19H23BN2O3/c1-18(2)19(3,4)25-20(24-18)16-7-5-15(6-8-16)17(23)22-13-14-9-11-21-12-10-14/h5-12H,13H2,1-4H3,(H,22,23)
InChI key:InChIKey=DDBHWKCYJNXKNG-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C2=CC=C(C(NCC=3C=CN=CC3)=O)C=C2
Synonyms:
  • Benzamide, N-(4-pyridinylmethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
  • N-(4-Pyridinylmethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.