
CAS 864754-33-6
:1-(2,2-Dimethoxyethyl)-3,5-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole
Description:
1-(2,2-Dimethoxyethyl)-3,5-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole, with CAS number 864754-33-6, is a chemical compound characterized by its complex structure that includes a pyrazole ring and a boron-containing moiety. The presence of the dimethoxyethyl group suggests good solubility in organic solvents, while the boron-dioxaborolane unit may impart unique reactivity, particularly in cross-coupling reactions or as a potential ligand in organometallic chemistry. The compound's multiple methyl groups contribute to its steric bulk, which can influence its reactivity and interactions with other molecules. Additionally, the presence of the pyrazole ring indicates potential biological activity, as pyrazoles are often found in pharmaceuticals and agrochemicals. Overall, this compound's unique structural features make it of interest in synthetic chemistry and potentially in medicinal chemistry applications.
Formula:C15H27BN2O4
InChI:InChI=1S/C15H27BN2O4/c1-10-13(16-21-14(3,4)15(5,6)22-16)11(2)18(17-10)9-12(19-7)20-8/h12H,9H2,1-8H3
InChI key:InChIKey=GPDPQVHSZMWXMV-UHFFFAOYSA-N
SMILES:CC1=C(B2OC(C)(C)C(C)(C)O2)C(C)=NN1CC(OC)OC
Synonyms:- 1H-Pyrazole, 1-(2,2-dimethoxyethyl)-3,5-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
- 1-(2,2-Dimethoxyethyl)-3,5-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1H-Pyrazole,1-(2,2-dimethoxyethyl)-3,5-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
CAS:Formula:C15H27BN2O4Molecular weight:310.1969
