CymitQuimica logo

CAS 864754-46-1

:

N-(4-Methyl-2-pyridinyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide

Description:
N-(4-Methyl-2-pyridinyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide, with CAS number 864754-46-1, is a chemical compound characterized by its complex structure that includes a pyridine ring and a boron-containing moiety. The presence of the 4-methyl-2-pyridinyl group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The boron-containing dioxaborolane group is notable for its role in various chemical reactions, including Suzuki coupling, which is significant in organic synthesis. This compound is likely to exhibit moderate to high solubility in organic solvents, and its stability may be influenced by environmental factors such as moisture and temperature. Additionally, the presence of functional groups may impart specific reactivity and interaction properties, making it a candidate for further study in drug development or materials science. Overall, this compound exemplifies the intersection of organic chemistry and medicinal applications, highlighting the importance of structural features in determining chemical behavior.
Formula:C19H23BN2O3
InChI:InChI=1S/C19H23BN2O3/c1-13-10-11-21-16(12-13)22-17(23)14-6-8-15(9-7-14)20-24-18(2,3)19(4,5)25-20/h6-12H,1-5H3,(H,21,22,23)
InChI key:InChIKey=SRNLWGKIMGETIM-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C2=CC=C(C(NC3=CC(C)=CC=N3)=O)C=C2
Synonyms:
  • Benzamide, N-(4-methyl-2-pyridinyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
  • N-(4-Methyl-2-pyridinyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide
  • N-(4-Methylpyridin-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.