CymitQuimica logo

CAS 864754-47-2

:

1,3,2-Dioxaborolane,2-[4-(2-fluoroethoxy)phenyl]-4,4,5,5-tetramethyl-

Description:
1,3,2-Dioxaborolane, 2-[4-(2-fluoroethoxy)phenyl]-4,4,5,5-tetramethyl- is a boron-containing heterocyclic compound characterized by its dioxaborolane ring structure, which features a five-membered cyclic arrangement containing two oxygen atoms and one boron atom. This compound is notable for its potential applications in organic synthesis and medicinal chemistry, particularly as a building block in the development of pharmaceuticals and agrochemicals. The presence of the 2-fluoroethoxy group and the tetramethyl substituents enhances its solubility and reactivity, making it a versatile intermediate in various chemical reactions. Additionally, the fluorine atom may impart unique electronic properties, influencing the compound's reactivity and interaction with biological targets. As with many boron-containing compounds, it may exhibit Lewis acid behavior, facilitating coordination with nucleophiles. Safety and handling precautions should be observed due to the potential reactivity of boron compounds and the presence of fluorine, which can pose health risks. Overall, this compound exemplifies the diverse chemistry associated with boron and its derivatives.
Formula:C14H20BFO3
InChI:InChI=1S/C14H20BFO3/c1-13(2)14(3,4)19-15(18-13)11-5-7-12(8-6-11)17-10-9-16/h5-8H,9-10H2,1-4H3
InChI key:RJQFPXYMWQGKNI-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OCCF
Synonyms:
  • 2-[4-(2-Fluoro-Ethoxy)-Phenyl]-4,4,5,5-Tetramethyl-[1,3,2]Dioxaborolane
Found 4 products.