CymitQuimica logo

CAS 864754-48-3

:

2-[4-(2,2-difluoroethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane

Description:
2-[4-(2,2-Difluoroethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is an organoboron compound characterized by its unique dioxaborolane structure, which features a boron atom bonded to two oxygen atoms and a carbon framework. This compound typically exhibits a stable, cyclic structure that can participate in various chemical reactions, particularly in organic synthesis and medicinal chemistry. The presence of the difluoroethoxy group enhances its solubility and reactivity, making it useful in applications such as drug development and material science. Additionally, the tetramethyl substituents contribute to its steric bulk, influencing its reactivity and interactions with other molecules. The compound may also exhibit interesting electronic properties due to the presence of the boron atom and the fluorinated group, which can affect its behavior in catalytic processes or as a ligand in coordination chemistry. Overall, this compound's unique structural features make it a valuable candidate for further research and application in various chemical fields.
Formula:C14H19BF2O3
InChI:InChI=1/C14H19BF2O3/c1-13(2)14(3,4)20-15(19-13)10-5-7-11(8-6-10)18-9-12(16)17/h5-8,12H,9H2,1-4H3
InChI key:QAZIETXLQXVGLM-UHFFFAOYSA-N
SMILES:CC1(C)C(C)(C)OB(c2ccc(cc2)OCC(F)F)O1
Found 4 products.