CAS 864754-51-8
:N-(3-Methyl-5-isothiazolyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide
Description:
N-(3-Methyl-5-isothiazolyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide is a synthetic organic compound characterized by its complex structure, which includes an isothiazole moiety and a boron-containing dioxaborolane group. This compound is typically used in research and development, particularly in the fields of medicinal chemistry and agrochemicals, due to its potential biological activity. The presence of the isothiazole ring suggests possible antimicrobial or antifungal properties, while the boron-containing group may enhance its stability or solubility in various solvents. The compound's molecular structure allows for various interactions, making it a candidate for further studies in drug design or as a chemical intermediate. Its specific physical properties, such as melting point, solubility, and reactivity, would depend on the conditions under which it is synthesized and stored. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.
Formula:C17H21BN2O3S
InChI:InChI=1S/C17H21BN2O3S/c1-11-10-14(24-20-11)19-15(21)12-6-8-13(9-7-12)18-22-16(2,3)17(4,5)23-18/h6-10H,1-5H3,(H,19,21)
InChI key:InChIKey=SVEFXBTZMGERJW-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C2=CC=C(C(NC=3SN=C(C)C3)=O)C=C2
Synonyms:- Benzamide, N-(3-methyl-5-isothiazolyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
- N-(3-METHYL-ISOTHIAZOL-5-YL)-4-(4,4,5,5-TETRAMETHYL-[1,3,2]DIOXABOROLAN-2-YL)-BENZAMIDE
- N-(3-Methyl-5-isothiazolyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Benzamide,N-(3-methyl-5-isothiazolyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
CAS:Formula:C17H21BN2O3SMolecular weight:344.2362
