CymitQuimica logo

CAS 864759-44-4

:

N-(2-Cyanoethyl)-N-(3-pyridinylmethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide

Description:
N-(2-Cyanoethyl)-N-(3-pyridinylmethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide, with CAS number 864759-44-4, is a chemical compound characterized by its complex structure, which includes a benzamide core substituted with a cyanoethyl group and a pyridinylmethyl moiety. The presence of the boron-containing dioxaborolane group suggests potential applications in organic synthesis and medicinal chemistry, particularly in the development of boron-based compounds for drug delivery or as intermediates in chemical reactions. This compound may exhibit unique properties such as solubility in organic solvents, stability under certain conditions, and reactivity due to the functional groups present. Its molecular structure indicates potential interactions with biological targets, making it of interest in pharmaceutical research. Additionally, the presence of the cyano and pyridine groups may contribute to its electronic properties, influencing its behavior in various chemical environments. Overall, this compound represents a versatile scaffold for further exploration in both synthetic and medicinal chemistry.
Formula:C22H26BN3O3
InChI:InChI=1S/C22H26BN3O3/c1-21(2)22(3,4)29-23(28-21)19-10-8-18(9-11-19)20(27)26(14-6-12-24)16-17-7-5-13-25-15-17/h5,7-11,13,15H,6,14,16H2,1-4H3
InChI key:InChIKey=YJYYCWQVNQVASK-UHFFFAOYSA-N
SMILES:CC1(C)OB(C2=CC=C(C(N(CC=3C=CC=NC3)CCC#N)=O)C=C2)OC1(C)C
Synonyms:
  • N-(2-Cyanoethyl)-N-(3-pyridinylmethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide
  • Benzamide, N-(2-cyanoethyl)-N-(3-pyridinylmethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.