CAS 864759-68-2

B-[3-Fluoro-4-(trifluoromethyl)phenyl]boronic acid

Description:

B-[3-Fluoro-4-(trifluoromethyl)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is substituted with both a fluorine atom and a trifluoromethyl group. This compound typically exhibits properties such as high reactivity due to the boronic acid moiety, which can participate in various chemical reactions, including Suzuki coupling, a key reaction in organic synthesis for forming carbon-carbon bonds. The presence of the trifluoromethyl group enhances the lipophilicity and stability of the compound, while the fluorine substitution can influence its electronic properties and reactivity. B-[3-Fluoro-4-(trifluoromethyl)phenyl]boronic acid is often utilized in medicinal chemistry and materials science, particularly in the development of pharmaceuticals and agrochemicals. Its unique structural features make it a valuable building block in the synthesis of complex organic molecules. As with many boronic acids, it is important to handle this compound with care, considering its potential reactivity and the need for appropriate storage conditions.

Formula: C₇H₅BF₄O₂

InChI: InChI=1S/C7H5BF4O2/c9-6-3-4(8(13)14)1-2-5(6)7(10,11)12/h1-3,13-14H

InChI key: InChIKey=OPDBJTGUPJBGII-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=C(F)C=C(B(O)O)C=C1

Synonyms:

• 3-Fluoro-4-trifluoromethylbenzeneboronic acid
• B-[3-Fluoro-4-(trifluoromethyl)phenyl]boronic acid
• Boronic acid, [3-fluoro-4-(trifluoromethyl)phenyl]-
• boronic acid, B-[3-fluoro-4-(trifluoromethyl)phenyl]-
• [3-Fluoro-4-(trifluoromethyl)phenyl]boronic acid

3-FLUORO-4-TRIFLUOROMETHYL-PHENYLBORONIC ACID

CAS: 864759-68-2

Formula: C₇H₅BF₄O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 207.9180

Ref: IN-DA008G2G

3-Fluoro-4-trifluoromethylphenylboronic acid

CAS: 864759-68-2

3-Fluoro-4-trifluoromethylphenylboronic acid

Purity: 97%

Molecular weight: 207.92g/mol

Ref: 54-PC412492

3-Fluoro-4-trifluoromethylphenyl boronic acid

CAS: 864759-68-2

Formula: C₇H₅BF₄O₂

Purity: 95%

Color and Shape: No data available.

Molecular weight: 207.92

Ref: 10-F050387