
CAS 86477-07-8
:2,3-Dimethyl 5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole-2,3-dicarboxylate
Description:
2,3-Dimethyl 5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole-2,3-dicarboxylate is a chemical compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyrazole moieties. This compound features two methyl groups at the 2 and 3 positions, contributing to its overall hydrophobic character. The presence of dicarboxylate functional groups indicates that it can participate in various chemical reactions, including esterification and amidation, making it potentially useful in synthetic organic chemistry. Its molecular structure suggests that it may exhibit interesting biological activities, although specific pharmacological properties would require further investigation. The compound is likely to be a solid at room temperature and may have moderate solubility in organic solvents. Safety data and handling precautions should be considered, as with any chemical substance, particularly regarding its reactivity and potential toxicity. Overall, 2,3-Dimethyl 5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole-2,3-dicarboxylate represents a versatile scaffold for further chemical exploration and application in various fields.
Formula:C10H12N2O4
InChI:InChI=1S/C10H12N2O4/c1-15-9(13)7-6-4-3-5-12(6)11-8(7)10(14)16-2/h3-5H2,1-2H3
InChI key:InChIKey=JCHDXWDBZTYGBH-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C2N(N=C1C(OC)=O)CCC2
Synonyms:- 4H-Pyrrolo[1,2-b]pyrazole-2,3-dicarboxylic acid, 5,6-dihydro-, 2,3-dimethyl ester
- 2,3-Dimethyl 5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole-2,3-dicarboxylate
- 4H-Pyrrolo[1,2-b]pyrazole-2,3-dicarboxylic acid, 5,6-dihydro-, dimethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
dimethyl 5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole-2,3-dicarboxylate
CAS:Formula:C10H12N2O4Molecular weight:224.2133
