CAS 864773-73-9
:2-(4,4,5-Trimethyl-1,3,2-dioxaborolan-2-yl)phenol
Description:
2-(4,4,5-Trimethyl-1,3,2-dioxaborolan-2-yl)phenol, with the CAS number 864773-73-9, is an organic compound that features a phenolic structure substituted with a dioxaborolane moiety. This compound typically exhibits characteristics associated with both phenols and boron-containing compounds. The presence of the dioxaborolane group suggests potential reactivity in cross-coupling reactions, making it valuable in organic synthesis, particularly in the formation of carbon-carbon bonds. The trimethyl substituents enhance its steric bulk, which can influence its reactivity and solubility. As a phenol, it may display acidic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions. Additionally, the compound may exhibit interesting optical properties due to its aromatic nature. Its applications could extend to materials science, medicinal chemistry, and catalysis, where boron compounds are often utilized for their unique reactivity and ability to stabilize reactive intermediates. Overall, this compound represents a versatile building block in synthetic organic chemistry.
Formula:C11H15BO3
InChI:InChI=1S/C11H15BO3/c1-8-11(2,3)15-12(14-8)9-6-4-5-7-10(9)13/h4-8,13H,1-3H3
InChI key:InChIKey=UQUSADHVMIRIGB-UHFFFAOYSA-N
SMILES:OC1=C(C=CC=C1)B2OC(C)(C)C(C)O2
Synonyms:- 2-(4,4,5-Trimethyl-1,3,2-dioxaborolan-2-yl)phenol
- Phenol, 2-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
