CAS 86483-54-7
:3-Quinolinecarboxylicacid, 7-chloro-1-cyclopropyl-6-fluoro-1,4-dihydro-4-oxo-, ethyl ester
Description:
3-Quinolinecarboxylic acid, 7-chloro-1-cyclopropyl-6-fluoro-1,4-dihydro-4-oxo-, ethyl ester, identified by CAS number 86483-54-7, is a chemical compound that belongs to the class of quinoline derivatives. This compound features a quinoline ring system, which is a bicyclic structure composed of a benzene ring fused to a pyridine ring. The presence of a carboxylic acid moiety indicates potential acidity, while the ethyl ester functional group suggests it can undergo hydrolysis to release the corresponding acid. The chlorine and fluorine substituents introduce halogen atoms that can influence the compound's reactivity and biological activity. The cyclopropyl group adds to the complexity of the structure, potentially affecting its conformational properties and interactions with biological targets. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its specific characteristics, such as solubility, melting point, and reactivity, would require further investigation through experimental studies.
Formula:C15H13ClFNO3
InChI:InChI=1S/C15H13ClFNO3/c1-2-21-15(20)10-7-18(8-3-4-8)13-6-11(16)12(17)5-9(13)14(10)19/h5-8H,2-4H2,1H3
InChI key:InChIKey=WFOACHMUKAYSPW-UHFFFAOYSA-N
SMILES:O=C1C=2C(N(C=C1C(OCC)=O)C3CC3)=CC(Cl)=C(F)C2
Synonyms:- 3-Quinolinecarboxylic acid, 7-chloro-1-cyclopropyl-6-fluoro-1,4-dihydro-4-oxo-, ethyl ester
- Ethyl 1-cyclopropyl-1,4-dihydro-4-oxo-6-fluoro-7-chloro-3-quinolinecarboxylate
- Ethyl1-cyclopropyl-1,4-dihydro-4-oxo-6-fluoro-7-chloro-3-quinolinecarboxylate
- Ethyl 7-chloro-1-cyclopropyl-6-fluoro-4-oxo-1,4-dihydroquinoline-3-carboxylate
- 7-CHLORO-1-CYCLOPROPYL-6-FLUORO-4-OXO-1,4-DIHYDRO-QUINOLINE-3-CARBOXYLIC ACID ETHYL ESTER
- ethyl 7-chloro-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Ethyl 7-Chloro-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylate
CAS:Controlled ProductFormula:C15H13ClFNO3Color and Shape:NeatMolecular weight:309.72

