CAS 864866-78-4

7-Bromo-2,3-dimethyl-4(3H)-quinazolinone

Description:

7-Bromo-2,3-dimethyl-4(3H)-quinazolinone is a heterocyclic organic compound characterized by its quinazolinone structure, which features a fused bicyclic system containing both a benzene and a pyrimidine ring. The presence of a bromine atom at the 7-position and two methyl groups at the 2 and 3 positions contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. It is of interest in medicinal chemistry due to its potential biological activities, including antimicrobial and anticancer properties. The bromine substituent can enhance reactivity and influence the compound's interaction with biological targets. Additionally, the dimethyl groups can affect the compound's lipophilicity and overall pharmacokinetic profile. As with many quinazolinone derivatives, it may serve as a scaffold for the development of new therapeutic agents. Proper handling and safety measures should be observed, as with all chemical substances, due to potential toxicity and reactivity.

Formula: C₁₀H₉BrN₂O

InChI: InChI=1S/C10H9BrN2O/c1-6-12-9-5-7(11)3-4-8(9)10(14)13(6)2/h3-5H,1-2H3

InChI key: InChIKey=ZBDUPUPSJBZOCC-UHFFFAOYSA-N

SMILES: O=C1C=2C(N=C(C)N1C)=CC(Br)=CC2

Synonyms:

• 4(3H)-Quinazolinone, 7-bromo-2,3-dimethyl-
• 7-Bromo-2,3-dimethylquinazolin-4(3H)-one
• 7-Bromo-2,3-dimethyl-4(3H)-quinazolinone