CymitQuimica logo

CAS 86491-83-0

:

3-[1-(2,4-dichlorophenyl)-2-(1H-imidazol-1-yl)ethoxy]propane-1,2-diol

Description:
3-[1-(2,4-Dichlorophenyl)-2-(1H-imidazol-1-yl)ethoxy]propane-1,2-diol, with the CAS number 86491-83-0, is a chemical compound characterized by its complex structure, which includes a dichlorophenyl group, an imidazole moiety, and a propane-1,2-diol backbone. This compound typically exhibits properties such as solubility in organic solvents, and it may have moderate to high polarity due to the presence of hydroxyl groups. The imidazole ring suggests potential biological activity, as imidazole derivatives are often involved in pharmacological applications. The dichlorophenyl group may contribute to the compound's lipophilicity and influence its interaction with biological targets. Additionally, the presence of multiple functional groups indicates that this compound could participate in various chemical reactions, including hydrogen bonding and nucleophilic substitutions. Overall, the unique combination of these structural features may confer specific reactivity and biological properties, making it of interest in medicinal chemistry and related fields.
Formula:C14H16Cl2N2O3
InChI:InChI=1/C14H16Cl2N2O3/c15-10-1-2-12(13(16)5-10)14(21-8-11(20)7-19)6-18-4-3-17-9-18/h1-5,9,11,14,19-20H,6-8H2
SMILES:c1cc(c(cc1Cl)Cl)C(Cn1ccnc1)OCC(CO)O
Synonyms:
  • 1,2-Propanediol, 3-(1-(2,4-dichlorophenyl)-2-(1H-imidazol-1-yl)ethoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.