CymitQuimica logo

CAS 86499-24-3

:

3-Azido-1,3,4,5-tetrahydro-2H-1-benzazepin-2-one

Description:
3-Azido-1,3,4,5-tetrahydro-2H-1-benzazepin-2-one is a chemical compound characterized by its unique bicyclic structure, which includes a benzene ring fused to a seven-membered nitrogen-containing ring. The presence of the azido group (-N3) introduces notable reactivity, making it a potential candidate for various synthetic applications, particularly in the field of medicinal chemistry and materials science. This compound typically exhibits properties such as moderate solubility in organic solvents and stability under standard laboratory conditions, although it may be sensitive to heat and light due to the azido functional group. The nitrogen atoms in the structure contribute to its basicity and potential for forming coordination complexes. Additionally, the compound's molecular framework may influence its biological activity, making it of interest for further research in drug development. As with many azido compounds, safety precautions are essential during handling due to the potential for explosive decomposition under certain conditions.
Formula:C10H10N4O
InChI:InChI=1S/C10H10N4O/c11-14-13-9-6-5-7-3-1-2-4-8(7)12-10(9)15/h1-4,9H,5-6H2,(H,12,15)
InChI key:InChIKey=PDFYKDYEFKYENU-UHFFFAOYSA-N
SMILES:O=C1NC=2C(CCC1N=[N+]=[N-])=CC=CC2
Synonyms:
  • 2H-1-Benzazepin-2-one, 3-azido-1,3,4,5-tetrahydro-
  • 3-Azido-1,3,4,5-tetrahydro-1-benzazepin-2-one
  • 3-Azido-1,3,4,5-tetrahydro-2H-1-benzazepin-2-on
  • 3-Azido-2,3,4,5-tetrahydro-1H-1-benzazepin-2-one
  • 3-Azido-1,3,4,5-tetrahydro-2H-1-benzazepin-2-one
Found 6 products.