CymitQuimica logo

CAS 86499-25-4

:

Phenylmethyl 3-azido-2,3,4,5-tetrahydro-2-oxo-1H-1-benzazepine-1-acetate

Description:
Phenylmethyl 3-azido-2,3,4,5-tetrahydro-2-oxo-1H-1-benzazepine-1-acetate, with CAS number 86499-25-4, is a chemical compound that belongs to the class of benzazepines, which are bicyclic compounds containing a benzene ring fused to a seven-membered nitrogen-containing ring. This specific compound features an azido group, which is known for its reactivity and potential use in click chemistry. The presence of the acetate moiety suggests that it may exhibit ester-like properties, influencing its solubility and reactivity. The tetrahydro structure indicates that the compound is partially saturated, which can affect its stability and interaction with biological systems. Overall, this compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique structural features and functional groups that can participate in various chemical reactions. However, detailed studies on its biological activity, toxicity, and specific applications would be necessary to fully understand its potential uses.
Formula:C19H18N4O3
InChI:InChI=1S/C19H18N4O3/c20-22-21-16-11-10-15-8-4-5-9-17(15)23(19(16)25)12-18(24)26-13-14-6-2-1-3-7-14/h1-9,16H,10-13H2
InChI key:InChIKey=FXZOZBDSJDUFOV-UHFFFAOYSA-N
SMILES:C(C(OCC1=CC=CC=C1)=O)N2C=3C(CCC(N=[N+]=[N-])C2=O)=CC=CC3
Synonyms:
  • 1H-1-Benzazepine-1-acetic acid, 3-azido-2,3,4,5-tetrahydro-2-oxo-, phenylmethyl ester
  • Phenylmethyl 3-azido-2,3,4,5-tetrahydro-2-oxo-1H-1-benzazepine-1-acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.