CAS 865-24-7
:Vinglycinate
Description:
Vinglycinate, with the CAS number 865-24-7, is a chemical compound that belongs to the class of amino acid derivatives. It is characterized by its structure, which typically includes an amino group, a carboxylic acid group, and a side chain that can vary depending on the specific amino acid it is derived from. Vinglycinate is often used in biochemical research and pharmaceutical applications due to its potential role as a neurotransmitter or in metabolic processes. The compound is generally soluble in water, which facilitates its use in various biological systems. Its properties may include a relatively low molecular weight and the ability to participate in hydrogen bonding, making it reactive in certain chemical environments. Additionally, vinglycinate may exhibit specific biological activities, such as influencing enzyme function or acting as a substrate in metabolic pathways. However, detailed information regarding its toxicity, stability, and specific applications would require further investigation and context within the field of chemistry.
Formula:C48H63N5O9
InChI:InChI=1S/C48H63N5O9/c1-9-44(57)24-29-25-47(42(55)60-7,38-31(16-20-52(26-29)28-44)30-14-11-12-15-34(30)49-38)33-22-32-35(23-36(33)59-6)51(5)40-46(32)18-21-53-19-13-17-45(10-2,39(46)53)41(48(40,58)43(56)61-8)62-37(54)27-50(3)4/h11-15,17,22-23,29,39-41,49,57-58H,9-10,16,18-21,24-28H2,1-8H3
InChI key:InChIKey=YNSIUGHLISOIRQ-UHFFFAOYSA-N
SMILES:C(C)C12C3C4(C(C(C(OC)=O)(O)C1OC(CN(C)C)=O)N(C)C=5C4=CC(=C(OC)C5)C6(C(OC)=O)C7=C(C=8C(N7)=CC=CC8)CCN9CC(C6)CC(CC)(O)C9)CCN3CC=C2
Synonyms:- Vincaleukoblastine, O(sup 4)-deacetyl-, 4-ester with N,N-dimethylglycine
- Vincaleukoblastine, 4-deacetyl-, 4-ester with N,N-dimethylglycine
- (2alpha,3alpha,4alpha,5beta,19beta)-(dimethylamino)vincaleukoblastine
- Vinglycinatum [INN-Latin]
- 1H-Indolizino[8,1-cd]carbazole, vincaleukoblastine deriv.
- O(sup 4)-Deacetylvincaleukoblastine 4-ester with N,N-dimethylglycine
- Vincaleukoblastine, deacetyl-, 4-ester with N,N-dimethylglycine
- Vinglicinato
- Vincaleukoblastine, O4-deacetyl-, 4-ester with N,N-dimethylglycine
- Vinglycinate [INN]
- Vinglicinato [INN-Spanish]
- BRN 1207061
- Deacetylvincaleukoblastine 4-ester with N,N-dimethylglycine
- Vinglycinatum
- Vinglycinate
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Vinglycinate
CAS:<p>Vinglycinate is a biochemical.</p>Formula:C48H63N5O9Color and Shape:SolidMolecular weight:854.058
