CAS 86505-94-4

methyl 2-amino-6-fluorobenzoate

Description:

Methyl 2-amino-6-fluorobenzoate, with the CAS number 86505-94-4, is an organic compound characterized by its aromatic structure, which includes a benzoate moiety substituted with both an amino group and a fluorine atom. This compound typically appears as a white to off-white solid and is soluble in organic solvents, reflecting its polar functional groups. The presence of the amino group (-NH2) contributes to its basicity and potential reactivity, while the fluorine atom enhances its lipophilicity and can influence its biological activity. Methyl 2-amino-6-fluorobenzoate may be utilized in various applications, including pharmaceuticals and agrochemicals, due to its potential as a building block in the synthesis of more complex molecules. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on the conditions and purity of the sample. As with many chemical substances, safety precautions should be observed when handling this compound, including the use of appropriate personal protective equipment.

Formula: C₈H₈FNO₂

InChI: InChI=1/C8H8FNO2/c1-12-8(11)7-5(9)3-2-4-6(7)10/h2-4H,10H2,1H3

SMILES: COC(=O)c1c(cccc1N)F

Synonyms:

• Benzoic Acid, 2-Amino-6-Fluoro-, Methyl Ester

Methyl 2-Amino-6-fluorobenzoate

CAS: 86505-94-4

Formula: C₈H₈FNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 169.1530

Ref: IN-DA0036DS

Methyl 2-amino-6-fluorobenzoate

CAS: 86505-94-4

Methyl 2-amino-6-fluorobenzoate

Purity: 98%

Molecular weight: 169.15g/mol

Ref: 54-PC300536

Methyl 2-Amino-6-fluorobenzoate

CAS: 86505-94-4

Formula: C₈H₈FNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 169.155

Ref: 10-F066758